412281-11-9 Usage
Uses
Used in Pharmaceutical Industry:
1-Methyl-pyrrolidine-3-carboxylic acid hydrochloride is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of a wide range of drug molecules, making it a valuable component in the development of new medications.
Used in Chemical Synthesis:
1-Methyl-pyrrolidine-3-carboxylic acid hydrochloride is used as a building block in the synthesis of complex organic molecules. Its versatile structure enables the formation of various chemical entities, which can be further utilized in the production of specialty chemicals, agrochemicals, and other industrial applications.
Used in Research and Development:
1-Methyl-pyrrolidine-3-carboxylic acid hydrochloride is employed as a research compound in academic and industrial laboratories. Its properties and reactivity are studied to understand its potential applications and to develop new synthetic routes for the production of related compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 412281-11-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,2,2,8 and 1 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 412281-11:
(8*4)+(7*1)+(6*2)+(5*2)+(4*8)+(3*1)+(2*1)+(1*1)=99
99 % 10 = 9
So 412281-11-9 is a valid CAS Registry Number.
InChI:InChI=1S/C6H11NO2/c1-7-3-2-5(4-7)6(8)9/h5H,2-4H2,1H3,(H,8,9)
