4180-57-8 Usage
Uses
Used in Pharmaceutical Synthesis:
4-(2,3-Dihydroxypropoxy)benzoic acid is utilized as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of drugs with various therapeutic purposes. Its unique structure allows for the creation of molecules with specific biological activities, enhancing the range of treatments available in medicine.
Used in Bioactive Molecule Synthesis:
In the field of bioactive molecule synthesis, 4-(2,3-Dihydroxypropoxy)benzoic acid serves as a versatile building block. Its incorporation into the molecular structures of bioactive compounds can lead to the discovery of new agents with potential applications in healthcare and pharmaceuticals.
Used in Chemical Research:
4-(2,3-Dihydroxypropoxy)benzoic acid is also employed in chemical research as a model compound for studying the properties and reactions of benzoic acid derivatives. This contributes to a deeper understanding of organic chemistry and can inspire the design of novel chemical processes and compounds.
Used in Organic Compound Synthesis:
As a building block for the synthesis of other organic compounds, 4-(2,3-Dihydroxypropoxy)benzoic acid is instrumental in the creation of a variety of chemical entities. Its presence in these syntheses can lead to the development of new materials, catalysts, or other specialty chemicals with specific applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 4180-57-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,1,8 and 0 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4180-57:
(6*4)+(5*1)+(4*8)+(3*0)+(2*5)+(1*7)=78
78 % 10 = 8
So 4180-57-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H12O5/c11-5-8(12)6-15-9-3-1-7(2-4-9)10(13)14/h1-4,8,11-12H,5-6H2,(H,13,14)
