420137-10-6 Usage
Uses
Used in Pharmaceutical Industry:
3-(2-Methoxy-Benzyl)-Piperidine is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, particularly in the areas of central nervous system medications and other therapeutic applications.
Used in Chemical Reactions:
3-(2-Methoxy-Benzyl)-Piperidine is used as a reactant in various chemical reactions. Its versatile structure enables it to participate in a range of synthesis processes, contributing to the production of different organic compounds and materials.
Used in Research and Development:
3-(2-Methoxy-Benzyl)-Piperidine is used as a research compound for studying its properties and potential applications. Its unique structure and reactivity make it an interesting subject for scientific investigations, which can lead to new discoveries and advancements in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 420137-10-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,0,1,3 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 420137-10:
(8*4)+(7*2)+(6*0)+(5*1)+(4*3)+(3*7)+(2*1)+(1*0)=86
86 % 10 = 6
So 420137-10-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO/c1-15-13-7-3-2-6-12(13)9-11-5-4-8-14-10-11/h2-3,6-7,11,14H,4-5,8-10H2,1H3
