426831-08-5 Usage
Uses
Used in Pharmaceutical Industry:
4-[3-(Dimethylamino)propoxy]phenylmethanol is used as a precursor in the synthesis of various drugs and organic compounds. Its unique structure allows it to be a valuable building block for the development of new pharmaceutical agents.
Used in Organic Synthesis:
In the field of organic synthesis, 4-[3-(Dimethylamino)propoxy]phenylmethanol serves as a key intermediate for the production of a range of organic compounds. Its functional groups enable it to participate in various chemical reactions, facilitating the creation of diverse molecules.
Used in Materials Science:
4-[3-(Dimethylamino)propoxy]phenylmethanol may have potential applications in materials science, where its unique structure could contribute to the development of new materials with specific properties. Its versatility makes it a candidate for use in the design of advanced materials.
Used in Chemical Engineering:
In chemical engineering, 4-[3-(Dimethylamino)propoxy]phenylmethanol could be utilized in the development of novel processes and technologies. Its unique structure may offer advantages in the synthesis of complex organic compounds or in the improvement of existing chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 426831-08-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,6,8,3 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 426831-08:
(8*4)+(7*2)+(6*6)+(5*8)+(4*3)+(3*1)+(2*0)+(1*8)=145
145 % 10 = 5
So 426831-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H19NO2/c1-13(2)8-3-9-15-12-6-4-11(10-14)5-7-12/h4-7,14H,3,8-10H2,1-2H3
426831-08-5Relevant articles and documents
2-OXO-3,4-DIHYDROPYRIDINE-5-CARBOXYLATES AND THEIR USE
-
Page/Page column 132, (2016/04/20)
The present invention is directed to novel compounds of Formula (I), pharmaceutically acceptable salts or solvates thereof, and their use.
