436086-79-2 Usage
Uses
Used in Chemical Synthesis:
BENZYL-(3-FLUORO-BENZYL)-AMINE is used as a building block in chemical synthesis for creating a variety of complex organic molecules. Its unique structure allows for versatile reactions and the formation of new compounds with potential applications in various industries.
Used in Pharmaceutical Industry:
BENZYL-(3-FLUORO-BENZYL)-AMINE is used as an intermediate in the synthesis of pharmaceutical compounds. Its presence in the molecule can influence the pharmacological properties, such as solubility, stability, and bioavailability, making it a valuable component in the development of new drugs.
Used in Materials Science:
BENZYL-(3-FLUORO-BENZYL)-AMINE is used as a component in the development of new materials with specific properties. Its incorporation into polymers or other materials can result in improved characteristics, such as enhanced thermal stability, mechanical strength, or chemical resistance, depending on the application.
Check Digit Verification of cas no
The CAS Registry Mumber 436086-79-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 6 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 436086-79:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*6)+(2*7)+(1*9)=162
162 % 10 = 2
So 436086-79-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H14FN/c15-14-8-4-7-13(9-14)11-16-10-12-5-2-1-3-6-12/h1-9,16H,10-11H2/p+1