436086-97-4 Usage
Uses
Used in Pharmaceutical Industry:
N-(4-PIPERIDIN-1-YL-PHENYL)-SUCCINAMIC ACID is used as a pharmaceutical intermediate for the synthesis of various drugs, leveraging its chemical structure to contribute to the development of new medicinal compounds.
Used in Organic Synthesis:
In the field of organic synthesis, N-(4-PIPERIDIN-1-YL-PHENYL)-SUCCINAMIC ACID serves as a valuable building block, facilitating the creation of complex organic molecules for a range of applications.
Used in Medicinal Chemistry:
N-(4-PIPERIDIN-1-YL-PHENYL)-SUCCINAMIC ACID is utilized in medicinal chemistry for its potential biological activities, which may lead to the discovery of new therapeutic agents and contribute to advancements in drug design and development.
Check Digit Verification of cas no
The CAS Registry Mumber 436086-97-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,8 and 6 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 436086-97:
(8*4)+(7*3)+(6*6)+(5*0)+(4*8)+(3*6)+(2*9)+(1*7)=164
164 % 10 = 4
So 436086-97-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H20N2O3/c18-14(8-9-15(19)20)16-12-4-6-13(7-5-12)17-10-2-1-3-11-17/h4-7H,1-3,8-11H2,(H,16,18)(H,19,20)/p-1
