441295-75-6 Usage
Uses
Used in Pharmaceutical Synthesis:
4-N-FMOC-AMINOMETHYL PIPERIDINE is used as a key building block in the synthesis of various pharmaceutical drugs and organic compounds. Its stability and reactivity make it an essential component in the development of novel drug candidates, contributing to the advancement of medicinal chemistry.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-N-FMOC-AMINOMETHYL PIPERIDINE is utilized as a valuable research tool. Its unique properties allow scientists to explore its potential in the creation of new compounds with therapeutic applications, enhancing the discovery of innovative treatments for various diseases and conditions.
Used in the Treatment of Neurological and Psychiatric Disorders:
4-N-FMOC-AMINOMETHYL PIPERIDINE is being investigated for its potential application in the treatment of certain neurological and psychiatric disorders. Its ability to interact with neurotransmitter systems in the central nervous system suggests that it may play a role in the development of new therapies for conditions such as depression, anxiety, and other mental health disorders.
Overall, 4-N-FMOC-AMINOMETHYL PIPERIDINE is a multifaceted chemical with diverse applications in both research and practical settings, making it an indispensable asset in the field of chemistry and pharmaceutical development.
Check Digit Verification of cas no
The CAS Registry Mumber 441295-75-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,1,2,9 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 441295-75:
(8*4)+(7*4)+(6*1)+(5*2)+(4*9)+(3*5)+(2*7)+(1*5)=146
146 % 10 = 6
So 441295-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H24N2O2/c24-21(23-13-15-9-11-22-12-10-15)25-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,15,20,22H,9-14H2,(H,23,24)