475057-86-4 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Pyridinecarbonitrile,4-hydroxy-(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to participate in multiple chemical reactions and facilitate the production of diverse organic compounds.
Used in Agrochemical Production:
In the agrochemical industry, 2-Pyridinecarbonitrile,4-hydroxy-(9CI) is utilized as a building block for the development of new agrochemicals, leveraging its versatile reactivity to create effective compounds for agricultural applications.
Used in Medicinal Research:
2-Pyridinecarbonitrile,4-hydroxy-(9CI) is employed as a potential candidate in medicinal research due to its possible biological activity, offering opportunities for the discovery of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 475057-86-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,5,0,5 and 7 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 475057-86:
(8*4)+(7*7)+(6*5)+(5*0)+(4*5)+(3*7)+(2*8)+(1*6)=174
174 % 10 = 4
So 475057-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5NO/c1-2-6-5-7(9)3-4-8-6/h1,3-5H,(H,8,9)
475057-86-4Relevant articles and documents
Drug efflux pump inhibitor
-
, (2008/06/13)
A medicament for preventive and/or therapeutic treatment of a microbial infection which comprises as an active ingredient a compound represented by the following general formula (I): wherein, R1 and R2 represent hydrogen atom, a halogen atom, hydroxyl group or the like, W1 represents —CH═CH—, —CH2O—, —CH2CH2— or the like; R3 represents hydrogen atom, a halogen atom, hydroxyl group or an amino group; R4 represents hydrogen atom, a group of —OZ0-4R5 (Z0-4 represents an alkylene group, a fluorine-substituted alkylene group or a single bond, and R5 represents a cyclic alkyl group, an aryl group or the like); W2 represents a single bond or —C(R8)═C(R9)— (R8 and R9 represent hydrogen atom, a halogen atom, a lower alkyl group or the like, Q represents an acidic group, but W2 and Q may together form vinylidenethiazolidinedione or an equivalent heterocyclic ring; m and n represent an integer of 0 to 2, and q represents an integer of 0 to 3.