475060-18-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Acetamido-5-amino-4-picoline is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of novel drug molecules. Its unique structure allows for the creation of compounds with potential therapeutic applications, enhancing the range of treatments available for various medical conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 2-Acetamido-5-amino-4-picoline is utilized as a building block for the creation of complex organic molecules. Its functional groups facilitate multiple types of chemical reactions, making it a valuable component in the synthesis of a wide array of organic compounds.
Used in Drug Discovery:
2-Acetamido-5-amino-4-picoline is employed in drug discovery as a potential candidate for the development of new medications. Its chemical properties and potential biological activities are under investigation to explore its efficacy and safety in treating specific diseases or conditions.
Used in Medicinal Chemistry Research:
2-ACETAMIDO-5-AMINO-4-PICOLINE is used as a subject of study in medicinal chemistry research to understand its interactions with biological targets and its potential to modulate biological processes. The insights gained from such research can guide the design of more effective and safer drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 475060-18-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,5,0,6 and 0 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 475060-18:
(8*4)+(7*7)+(6*5)+(5*0)+(4*6)+(3*0)+(2*1)+(1*8)=145
145 % 10 = 5
So 475060-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O/c1-5-3-8(11-6(2)12)10-4-7(5)9/h3-4H,9H2,1-2H3,(H,10,11,12)
475060-18-5Relevant articles and documents
MexAB-OprM specific efflux pump inhibitors in Pseudomonas aeruginosa. Part 4: Addressing the problem of poor stability due to photoisomerization of an acrylic acid moiety
Nakayama, Kiyoshi,Kuru, Noriko,Ohtsuka, Masami,Yokomizo, Yoshihiro,Sakamoto, Atsunobu,Kawato, Haruko,Yoshida, Ken-Ichi,Ohta, Toshiharu,Hoshino, Kazuki,Akimoto, Katsuya,Itoh, Junko,Ishida, Hiroko,Cho, Aesop,Palme, Monica H.,Zhang, Jason Z.,Lee, Ving J.,Watkins, William J.
, p. 2493 - 2497 (2007/10/03)
Exchange of the ethylene tether in a series of pyridopyrimidine-based MexAB-OprM specific efflux pump inhibitors to an amide bond stabilized the olefin of the acrylic acid moiety, preventing facile photoisomerization to the Z-isomer. Furthermore, the activity was drastically improved in the amide tether variants, providing extremely potent acrylic acid and vinyl tetrazole analogues.
Drug efflux pump inhibitor
-
, (2008/06/13)
A medicament for preventive and/or therapeutic treatment of a microbial infection which comprises as an active ingredient a compound represented by the following general formula (I): wherein, R1 and R2 represent hydrogen atom, a halogen atom, hydroxyl group or the like, W1 represents —CH═CH—, —CH2O—, —CH2CH2— or the like; R3 represents hydrogen atom, a halogen atom, hydroxyl group or an amino group; R4 represents hydrogen atom, a group of —OZ0-4R5 (Z0-4 represents an alkylene group, a fluorine-substituted alkylene group or a single bond, and R5 represents a cyclic alkyl group, an aryl group or the like); W2 represents a single bond or —C(R8)═C(R9)— (R8 and R9 represent hydrogen atom, a halogen atom, a lower alkyl group or the like, Q represents an acidic group, but W2 and Q may together form vinylidenethiazolidinedione or an equivalent heterocyclic ring; m and n represent an integer of 0 to 2, and q represents an integer of 0 to 3.
