478646-32-1 Usage
Uses
Used in Pharmaceutical Drug Development:
(R)-3-N-CBZ-AMINO-PIPERIDINE is used as a key intermediate in the synthesis of pharmaceutical drugs. Its unique structure and the presence of the Cbz protecting group allow for controlled reactions, facilitating the creation of complex drug molecules with specific therapeutic properties.
Used in Organic Synthesis:
In the field of organic synthesis, (R)-3-N-CBZ-AMINO-PIPERIDINE is utilized as a versatile building block. Its reactivity can be finely tuned through the Cbz group, enabling the synthesis of a wide array of organic compounds with diverse applications.
Used in Medicinal Chemistry Research:
(R)-3-N-CBZ-AMINO-PIPERIDINE is employed as a starting material in medicinal chemistry research. Its potential to be modified and incorporated into various molecular frameworks makes it a promising candidate for the development of new therapeutic agents aimed at treating different diseases and conditions.
Used in the Synthesis of Bioactive Compounds:
(R)-3-N-CBZ-AMINO-PIPERIDINE is also used in the synthesis of bioactive compounds, where its unique structural features and reactivity contribute to the creation of molecules with specific biological activities, potentially leading to the discovery of new drugs and treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 478646-32-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,8,6,4 and 6 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 478646-32:
(8*4)+(7*7)+(6*8)+(5*6)+(4*4)+(3*6)+(2*3)+(1*2)=201
201 % 10 = 1
So 478646-32-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H18N2O2/c16-13(15-12-7-4-8-14-9-12)17-10-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2,(H,15,16)/t12-/m1/s1
