480438-55-9 Usage
Uses
Used in Organic Chemistry:
4-Butoxy-3-chlorophenylboronic acid is used as a reagent in palladium-catalyzed coupling reactions for the synthesis of natural products, pharmaceutical compounds, and diverse materials science applications. Its role in these reactions is crucial, as it facilitates the formation of new carbon-carbon or carbon-heteroatom bonds, which are essential for the construction of complex molecular structures.
Used in Pharmaceutical Compound Synthesis:
In the pharmaceutical industry, 4-Butoxy-3-chlorophenylboronic acid is used as a key intermediate in the synthesis of various drug molecules. Its participation in coupling reactions allows for the creation of new chemical entities with potential therapeutic applications, contributing to the development of novel medications.
Used in Materials Science Applications:
4-Butoxy-3-chlorophenylboronic acid is employed as a reagent in the synthesis of advanced materials, such as polymers, nanomaterials, and organic electronic devices. Its involvement in coupling reactions enables the creation of new materials with unique properties, such as improved conductivity, stability, or functionality, which can be utilized in various technological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-55-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 480438-55:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*5)+(1*5)=159
159 % 10 = 9
So 480438-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BClO3/c1-2-3-6-15-10-5-4-8(11(13)14)7-9(10)12/h4-5,7,13-14H,2-3,6H2,1H3
