480438-73-1 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Fluoro-2-propoxyphenylboronic acid is used as a reagent in the synthesis of pharmaceutical drugs, specifically through the Suzuki-Miyaura cross-coupling reactions. This method allows for the creation of complex organic compounds that are vital in the development of new medications.
Used in Scientific Research:
In the field of scientific research, 5-Fluoro-2-propoxyphenylboronic acid is employed as a reagent for various chemical reactions and studies. Its role in Suzuki-Miyaura cross-coupling reactions makes it a valuable tool for researchers working on the synthesis of complex organic molecules and compounds.
Used in Organic Chemistry:
5-Fluoro-2-propoxyphenylboronic acid is used as a reagent in organic chemistry, particularly for the synthesis of complex organic compounds. Its application in cross-coupling reactions contributes to the advancement of organic chemistry by enabling the creation of new and intricate molecular structures.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-73-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 480438-73:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*7)+(1*3)=161
161 % 10 = 1
So 480438-73-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BFO3/c1-2-5-14-9-4-3-7(11)6-8(9)10(12)13/h3-4,6,12-13H,2,5H2,1H3
