490028-18-7 Usage
Uses
Used in Pharmaceutical Industry:
4-Iodophenyl 2,3,4-Tri-O-acetyl--D-glucuronide Methyl Ester is used as an intermediate for the synthesis of glucuronide conjugates of trans-Resveratrol. This application is significant because it plays a crucial role in the development of pharmaceutical compounds that can potentially offer health benefits.
Used in Chemical Industry:
In the chemical industry, 4-Iodophenyl 2,3,4-Tri-O-acetyl--D-glucuronide Methyl Ester is used as a white solid with specific chemical properties. Its unique characteristics make it a valuable component in the synthesis of various chemical compounds, contributing to the development of new products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 490028-18-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,9,0,0,2 and 8 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 490028-18:
(8*4)+(7*9)+(6*0)+(5*0)+(4*2)+(3*8)+(2*1)+(1*8)=137
137 % 10 = 7
So 490028-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H21IO10/c1-9(21)26-14-15(27-10(2)22)17(28-11(3)23)19(30-16(14)18(24)25-4)29-13-7-5-12(20)6-8-13/h5-8,14-17,19H,1-4H3/t14-,15-,16?,17-,19+/m0/s1