51421-16-0 Usage
Uses
Used in Pharmaceutical Industry:
(3-FLUORO-BENZYL)-HYDRAZINE is used as a synthetic intermediate for the production of various pharmaceutical compounds. Its unique molecular structure allows it to serve as a building block in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
In the field of chemical research, (3-FLUORO-BENZYL)-HYDRAZINE is utilized as a reagent in various chemical reactions, enabling the synthesis of complex organic molecules. Its reactivity and the presence of the fluorine atom make it a valuable tool for exploring novel chemical pathways and developing innovative synthetic methods.
Used in Material Science:
(3-FLUORO-BENZYL)-HYDRAZINE can be employed in the development of new materials with specific properties, such as improved stability, reactivity, or selectivity. Its incorporation into polymers or other materials can lead to the creation of advanced materials with applications in various industries, including electronics, coatings, and adhesives.
Used in Agrochemical Industry:
As a synthetic intermediate, (3-FLUORO-BENZYL)-HYDRAZINE may also find applications in the agrochemical industry, where it can be used to develop new pesticides or herbicides with enhanced efficacy and selectivity. Its unique molecular structure can contribute to the design of novel agrochemicals that target specific pests or weeds while minimizing environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 51421-16-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,4,2 and 1 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 51421-16:
(7*5)+(6*1)+(5*4)+(4*2)+(3*1)+(2*1)+(1*6)=80
80 % 10 = 0
So 51421-16-0 is a valid CAS Registry Number.
InChI:InChI=1S/C7H9FN2/c8-7-3-1-2-6(4-7)5-10-9/h1-4,10H,5,9H2
