515845-97-3 Usage
Uses
Used in Pharmaceutical Industry:
5-BROMO-2-BUTOXY-BENZONITRILE is used as an intermediate in the synthesis of various drugs and medications, contributing to the development of new pharmaceutical products. Its role in the production process is crucial for creating effective and safe medications.
Used in Organic Synthesis:
5-BROMO-2-BUTOXY-BENZONITRILE is used as a building block for the synthesis of other organic compounds, playing a vital role in the creation of a wide range of chemical products. Its versatility in organic synthesis allows for the development of new compounds with various applications.
Used in Research and Development:
5-BROMO-2-BUTOXY-BENZONITRILE is employed in research and development for the exploration of new chemical reactions and the discovery of novel compounds. Its unique properties make it a valuable tool for scientists and researchers in advancing the field of chemistry and related disciplines.
Used in Chemical Education:
5-BROMO-2-BUTOXY-BENZONITRILE is utilized in chemical education to teach students about organic synthesis, chemical reactions, and the properties of various compounds. It serves as a practical example of a chemical intermediate and helps students understand the importance of proper handling and safety precautions in the laboratory.
Check Digit Verification of cas no
The CAS Registry Mumber 515845-97-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,1,5,8,4 and 5 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 515845-97:
(8*5)+(7*1)+(6*5)+(5*8)+(4*4)+(3*5)+(2*9)+(1*7)=173
173 % 10 = 3
So 515845-97-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H12BrNO/c1-2-3-6-14-11-5-4-10(12)7-9(11)8-13/h4-5,7H,2-3,6H2,1H3
