52386-30-8 Usage
Uses
Used in Pharmaceutical Industry:
6-AMINO-2-METHOXY-5-METHYLPYRIMIDIN-4(3H)-ONE is used as a chemical intermediate for the synthesis of various drugs. Its unique structure allows it to be a key component in the development of new pharmaceutical compounds, potentially leading to innovative treatments and therapies.
Used in Agrochemical Industry:
In the agrochemical sector, 6-AMINO-2-METHOXY-5-METHYLPYRIMIDIN-4(3H)-ONE serves as a building block in the creation of pesticides. Its incorporation into these products can enhance their effectiveness in controlling pests and diseases, thereby contributing to increased crop yields and agricultural productivity.
Used in Research and Development:
6-AMINO-2-METHOXY-5-METHYLPYRIMIDIN-4(3H)-ONE is also utilized as a subject of research for its potential therapeutic properties. Scientists are investigating its biological activities to uncover its full potential in treating various diseases and conditions, which could lead to the discovery of new medicines and healthcare solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 52386-30-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,3,8 and 6 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52386-30:
(7*5)+(6*2)+(5*3)+(4*8)+(3*6)+(2*3)+(1*0)=118
118 % 10 = 8
So 52386-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3O2/c1-3-4(7)8-6(11-2)9-5(3)10/h1-2H3,(H3,7,8,9,10)
