54203-05-3 Usage
Common uses
Flame retardant in plastics, textiles, and electronics
Effectiveness
Highly effective due to ability to release bromine radicals when exposed to heat, disrupting the combustion process and preventing the spread of flames
Environmental and health concerns
Release of bromine radicals can contribute to the formation of toxic byproducts and pose risks to human health
Regulation and restrictions
Increasing scrutiny and restrictions in various jurisdictions due to potential environmental and health impacts
Check Digit Verification of cas no
The CAS Registry Mumber 54203-05-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,2,0 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 54203-05:
(7*5)+(6*4)+(5*2)+(4*0)+(3*3)+(2*0)+(1*5)=83
83 % 10 = 3
So 54203-05-3 is a valid CAS Registry Number.
InChI:InChI=1/C21Br15N3O3/c22-1-4(25)10(31)16(11(32)5(1)26)40-19-37-20(41-17-12(33)6(27)2(23)7(28)13(17)34)39-21(38-19)42-18-14(35)8(29)3(24)9(30)15(18)36