554448-63-4 Usage
Uses
Used in Pharmaceutical Industry:
2-FLUORO-4-(N-MORPHOLINO)-BENZALDEHYDE serves as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with improved therapeutic properties, such as enhanced efficacy, selectivity, and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical sector, 2-FLUORO-4-(N-MORPHOLINO)-BENZALDEHYDE is utilized as an intermediate for the production of agrochemicals. Its incorporation into these compounds can lead to the development of more effective pesticides, herbicides, and other agricultural chemicals that are crucial for crop protection and yield enhancement.
Used in Fine Chemicals Industry:
2-FLUORO-4-(N-MORPHOLINO)-BENZALDEHYDE is also employed in the synthesis of fine chemicals, which are high-purity chemicals used in various applications such as fragrances, dyes, and specialty chemicals. Its unique properties enable the creation of novel fine chemicals with specific characteristics that cater to diverse market needs.
Used in Research and Development:
2-FLUORO-4-(N-MORPHOLINO)-BENZALDEHYDE is a vital component in research and development processes across the pharmaceutical and chemical industries. Its versatile reactivity and potential for creating new compounds with useful properties make it an indispensable tool for scientists and researchers working on innovative projects and breakthrough discoveries.
Check Digit Verification of cas no
The CAS Registry Mumber 554448-63-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,5,4,4,4 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 554448-63:
(8*5)+(7*5)+(6*4)+(5*4)+(4*4)+(3*8)+(2*6)+(1*3)=174
174 % 10 = 4
So 554448-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H12FNO2/c12-11-7-10(2-1-9(11)8-14)13-3-5-15-6-4-13/h1-2,7-8H,3-6H2
