569348-15-8 Usage
Uses
Used in Pharmaceutical Industry:
(1-Cbz-3-piperidine)carbothioamide is used as a building block for the development of new drugs and therapeutic agents. Its unique structure and reactivity allow for the creation of various pharmaceuticals and biologically active molecules, contributing to the advancement of medicinal chemistry.
Used in Organic Synthesis:
(1-Cbz-3-piperidine)carbothioamide is used as a key intermediate in organic synthesis, enabling the synthesis of complex organic compounds and facilitating the development of novel chemical reactions.
Used in Antimicrobial Applications:
(1-Cbz-3-piperidine)carbothioamide is studied for its potential antimicrobial properties, making it a promising candidate for the development of new antimicrobial agents to combat drug-resistant bacteria.
Used in Antifungal Applications:
(1-Cbz-3-piperidine)carbothioamide is also being investigated for its antifungal properties, offering the potential to develop new antifungal drugs to treat various fungal infections.
Check Digit Verification of cas no
The CAS Registry Mumber 569348-15-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,6,9,3,4 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 569348-15:
(8*5)+(7*6)+(6*9)+(5*3)+(4*4)+(3*8)+(2*1)+(1*5)=198
198 % 10 = 8
So 569348-15-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H18N2O2S/c15-13(19)12-7-4-8-16(9-12)14(17)18-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H2,15,19)
569348-15-8Relevant articles and documents
COMPOSITIONS OF FATOSTATIN BASED HETEROCYCLIC COMPOUNDS AND USES THEREOF
-
Page/Page column 16; 17, (2016/07/27)
The present invention relates to compounds, pharmaceutical compositions and formulations that have a structure (I). The compounds comprise a heterocyclic ring where W, X, Y, and Z generally and independently are S, N or C with the proviso that at least 2
