573-44-4 Usage
Uses
Used in Pharmaceutical Applications:
[[(3S)-3aα,4,6,6aα-Tetrahydro-1H,3H-furo[3,4-c]furan]-3α,6α-diyl]bis(2,6-dimethoxy-4,1-phenylene)bis(β-D-glucopyranoside) is used as a pharmaceutical compound for its potential therapeutic effects. [[(3S)-3aα,4,6,6aα-Tetrahydro-1H,3H-furo[3,4-c]furan]-3α,6α-diyl]bis(2,6-dimethoxy-4,1-phenylene)bis(β-D-glucopyranoside)'s unique structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Drug Delivery Systems:
In the field of drug delivery, [[(3S)-3aα,4,6,6aα-Tetrahydro-1H,3H-furo[3,4-c]furan]-3α,6α-diyl]bis(2,6-dimethoxy-4,1-phenylene)bis(β-D-glucopyranoside) can be employed as a carrier molecule to improve the delivery and bioavailability of other therapeutic agents. Its structural properties enable it to encapsulate or conjugate with drugs, enhancing their stability, solubility, and targeted release.
Used in Chemical Synthesis:
[[(3S)-3aα,4,6,6aα-Tetrahydro-1H,3H-furo[3,4-c]furan]-3α,6α-diyl]bis(2,6-dimethoxy-4,1-phenylene)bis(β-D-glucopyranoside) can also be utilized as a building block or intermediate in the synthesis of more complex organic compounds. Its versatile structure allows for further functionalization and modification, leading to the development of novel molecules with specific applications.
Used in Research and Development:
Due to its unique structure and potential applications, [[(3S)-3aα,4,6,6aα-Tetrahydro-1H,3H-furo[3,4-c]furan]-3α,6α-diyl]bis(2,6-dimethoxy-4,1-phenylene)bis(β-D-glucopyranoside) is valuable in research and development efforts. Scientists and chemists can use this compound to study various biological interactions, develop new synthetic methods, and explore its potential in different industries.
For example, the result for Liriodendrin is:
Used in Cardiovascular and Cerebrovascular Applications:
Liriodendrin is used as a Western medicine compound for the preparation of treatments aimed at preventing cardiovascular and cerebrovascular diseases. Its application is based on its potential to improve blood flow and reduce the risk of clot formation, thereby contributing to the overall health of the circulatory system.
Check Digit Verification of cas no
The CAS Registry Mumber 573-44-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,7 and 3 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 573-44:
(5*5)+(4*7)+(3*3)+(2*4)+(1*4)=74
74 % 10 = 4
So 573-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C46H66O30/c1-63-17-5-15(69-43-33(59)29(55)25(51)19(7-47)71-43)23(41(65-3)39(17)75-45-35(61)31(57)27(53)21(9-49)73-45)37-13-11-68-38(14(13)12-67-37)24-16(70-44-34(60)30(56)26(52)20(8-48)72-44)6-18(64-2)40(42(24)66-4)76-46-36(62)32(58)28(54)22(10-50)74-46/h5-6,13-14,19-22,25-38,43-62H,7-12H2,1-4H3/t13?,14?,19-,20-,21-,22-,25-,26-,27-,28-,29+,30+,31+,32+,33-,34-,35-,36-,37?,38?,43-,44-,45+,46+/m1/s1
573-44-4Relevant articles and documents
SYNTHESIS OF BIOLOGICALLY ACTIVE TETRAHYDROFUROFURANLIGNAN-(SYRINGIN, PINORESINOL)- MONO- AND BIS-GLYCOSIDES
Vermes, Barbara,Seligmann, Otto,Wagner, Hildebert
, p. 3087 - 3090 (2007/10/02)
The naturally occuring tetrahydrofurofuran-lignan-(syringaresinol, pinoresinol)-mono- and bis-glucosides were synthesized and their structures thereby confirmed.Key Word Index - Ligan-glucosides; synthesis; syringaresinol and pinoresinol glucosides.