59191-78-5 Usage
Uses
Used in the Flavor and Fragrance Industry:
3-(Hydroxymethyl)octan-2-one is used as a flavoring agent for its musty-herbaceous, sweet, and slightly earthy odor. It adds depth and complexity to the fragrances and flavors in various products, such as perfumes, colognes, and food items.
Used in the Pharmaceutical Industry:
3-(Hydroxymethyl)octan-2-one is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in the Chemical Synthesis Industry:
3-(Hydroxymethyl)octan-2-one serves as a versatile building block for the synthesis of other organic compounds. Its reactivity and functional groups make it a valuable starting material for creating a wide range of chemical products.
Used in the Cosmetics Industry:
3-(Hydroxymethyl)octan-2-one is used as a fragrance ingredient in the cosmetics industry. Its musty-herbaceous, sweet, and slightly earthy odor contributes to the overall scent profile of various cosmetic products, such as lotions, creams, and shampoos.
Preparation
By condensation of methyl hexyl ketone with formaldehyde, followed by hydrogenation.
Check Digit Verification of cas no
The CAS Registry Mumber 59191-78-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,1,9 and 1 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 59191-78:
(7*5)+(6*9)+(5*1)+(4*9)+(3*1)+(2*7)+(1*8)=155
155 % 10 = 5
So 59191-78-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H18O2/c1-3-4-5-6-9(7-10)8(2)11/h9-10H,3-7H2,1-2H3
