618092-42-5 Usage
Uses
Used in Pharmaceutical Industry:
1-(4-CHLORO-PHENYL)-5-METHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID HYDRAZIDE is used as a potential anticancer agent for its ability to target and inhibit the growth of cancer cells. Its unique chemical structure allows it to interact with specific biological targets, making it a promising candidate for the development of new cancer therapies.
Used in Agrochemical Industry:
1-(4-CHLORO-PHENYL)-5-METHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID HYDRAZIDE is used as a potential antibacterial agent for its ability to inhibit the growth of certain bacteria. This property can be harnessed in the development of new antimicrobial agents to combat bacterial infections and improve public health.
Check Digit Verification of cas no
The CAS Registry Mumber 618092-42-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,1,8,0,9 and 2 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 618092-42:
(8*6)+(7*1)+(6*8)+(5*0)+(4*9)+(3*2)+(2*4)+(1*2)=155
155 % 10 = 5
So 618092-42-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H11ClN4O/c1-7-10(11(17)15-13)6-14-16(7)9-4-2-8(12)3-5-9/h2-6H,13H2,1H3,(H,15,17)
