66787-75-5 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
5-Amino-1-methylimidazole is used as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure and functional groups make it a versatile component for the development of new drugs and pesticides.
Used in Materials Science:
In the field of materials science, 5-Amino-1-methylimidazole is utilized for its potential applications in the development of new materials with specific properties. Its ability to form complexes and participate in various chemical reactions contributes to the creation of innovative materials with tailored characteristics.
Used in Organic Synthesis:
As an intermediate in organic synthesis, 5-Amino-1-methylimidazole is employed for the preparation of a wide range of organic compounds. Its reactivity and structural features facilitate the synthesis of complex organic molecules for various applications.
Used in Antimicrobial and Antifungal Applications:
5-Amino-1-methylimidazole exhibits antimicrobial and antifungal properties, making it a valuable component in the development of new antimicrobial agents. Its ability to inhibit the growth of harmful microorganisms has potential applications in healthcare, agriculture, and other industries.
Used in Dye and Pigment Production:
In the production of dyes and pigments, 5-Amino-1-methylimidazole serves as an intermediate, contributing to the synthesis of various colorants used in different industries, such as textiles, plastics, and printing inks.
Used in Organic Light-Emitting Diodes (OLEDs):
5-Amino-1-methylimidazole has been studied for its potential use in organic light-emitting diodes, where its electronic properties and molecular structure can enhance the performance and efficiency of these devices.
Used in Corrosion Inhibition for Metal Coatings:
As a corrosion inhibitor, 5-Amino-1-methylimidazole is applied in metal coatings to protect against corrosion and extend the service life of metal surfaces. Its ability to form protective layers and inhibit corrosive processes makes it a promising candidate for use in various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 66787-75-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,7,8 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 66787-75:
(7*6)+(6*6)+(5*7)+(4*8)+(3*7)+(2*7)+(1*5)=185
185 % 10 = 5
So 66787-75-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2S/c10-8-6-12-9(11-8)7-4-2-1-3-5-7/h1-6H,10H2