677304-76-6 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Methoxybenzo[d]isothiazole-3-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drug candidates with potential therapeutic benefits.
Used in Organic Reactions:
As an intermediate in organic reactions, 5-Methoxybenzo[d]isothiazole-3-carboxylic acid plays a crucial role in the synthesis of various organic compounds. Its reactivity and functional groups enable the formation of diverse chemical products.
Used in Antitumor Research:
5-Methoxybenzo[d]isothiazole-3-carboxylic acid and its derivatives have been studied for their antitumor properties. They exhibit potential inhibitory effects on tumor growth and progression, making them valuable for the development of novel anticancer agents.
Used in Antimicrobial Applications:
5-Methoxybenzo[d]isothiazole-3-carboxylic acid has also shown promise in antimicrobial research, with potential applications in the development of new antimicrobial agents. Its ability to target and inhibit the growth of harmful microorganisms could contribute to the fight against antibiotic resistance.
Used in Drug Development:
The potential biological and pharmacological activities of 5-Methoxybenzo[d]isothiazole-3-carboxylic acid make it an attractive molecule for the development of new drugs. Its unique structure and properties can be harnessed to create innovative therapeutic agents with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 677304-76-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,7,3,0 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 677304-76:
(8*6)+(7*7)+(6*7)+(5*3)+(4*0)+(3*4)+(2*7)+(1*6)=186
186 % 10 = 6
So 677304-76-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO3S/c1-13-5-2-3-7-6(4-5)8(9(11)12)10-14-7/h2-4H,1H3,(H,11,12)
677304-76-6Relevant articles and documents
1 H-INDAZOLES, BENZOTHIAZOLES, 1,2-BENZOISOXAZOLES, 1,2-BENZOISOTHIAZOLES, AND CHROMONES AND PREPARATION AND USES THEREOF
-
Page/Page column 71, (2010/11/27)
The present invention relates generally to the field of ligands for nicotinic acetylcholine receptors (nAChR), activation of nAChRs, and the treatment of -disease conditions associated with defective or malfunctioning nicotinic acetylcholine receptors, especially of the brain. Further, this invention relates to novel compounds (indazoles and benzothiazoles), which act as ligands for the α7 nAChR subtype, methods of preparing such compounds, compositions containing such compounds, and methods of use thereof.
Indoles, 1h-indazoles, 1,2-benzisoxazoles, 1,2-benzoisothiazoles, and preparation and uses thereof
-
Page/Page column 39, (2008/06/13)
The present invention relates generally to the field of ligands for nicotinic acetylcholine receptors (nACh receptors), activation of nACh receptors, and the treatment of disease conditions associated with defective or malfunctioning nicotinic acetylcholine receptors, especially of the brain. Further, this invention relates to novel compounds (indazoles and benzothiazoles), which act as ligands for the α7 nACh receptor subtype, methods of preparing such compounds, compositions containing such compounds, and methods of use thereof.
