687985-65-5 Usage
Uses
Used in Chemical Synthesis:
3-BROMO-4-METHOXY-BENZAMIDINE is used as a building block in the synthesis of other organic compounds for various applications, including pharmaceuticals, agrochemicals, and materials science.
Used in Pharmaceutical Applications:
3-BROMO-4-METHOXY-BENZAMIDINE is used as a reagent in chemical reactions for the development of new pharmaceuticals, given its potential biological activities and enzyme inhibitory properties.
Used in Research Applications:
3-BROMO-4-METHOXY-BENZAMIDINE is used as a research compound to study its potential biological activities and to explore its applications in various fields, such as medicinal chemistry and drug discovery.
Used in Enzyme Inhibition:
3-BROMO-4-METHOXY-BENZAMIDINE is used as an enzyme inhibitor, which can be valuable in the development of drugs targeting specific enzymes involved in disease processes.
Check Digit Verification of cas no
The CAS Registry Mumber 687985-65-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,7,9,8 and 5 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 687985-65:
(8*6)+(7*8)+(6*7)+(5*9)+(4*8)+(3*5)+(2*6)+(1*5)=255
255 % 10 = 5
So 687985-65-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BrN2O/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,1H3,(H3,10,11)
