690632-68-9 Usage
Uses
Used in Organic Synthesis:
[6-(DIETHYLAMINO)-3-PYRIDINYL]METHANOL is used as a reagent in organic synthesis for its ability to facilitate the formation of desired products in chemical reactions, contributing to the development of new compounds and materials.
Used in Pharmaceutical Production:
As a precursor in the production of pharmaceuticals, [6-(DIETHYLAMINO)-3-PYRIDINYL]METHANOL plays a crucial role in the synthesis of various drugs, aiding in the creation of medicinal compounds that address specific health conditions.
Used in Asymmetric Synthesis:
[6-(DIETHYLAMINO)-3-PYRIDINYL]METHANOL is used as a chiral auxiliary in asymmetric synthesis reactions, enabling the production of enantiomerically pure compounds, which is essential for the development of new drugs and fine chemicals with specific biological activities.
Used in Catalyst Development:
Due to its unique structural and electronic properties, [6-(DIETHYLAMINO)-3-PYRIDINYL]METHANOL is studied for its potential use as a catalyst in various chemical reactions, aiming to improve reaction efficiency and selectivity in the synthesis of complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-68-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 690632-68:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*6)+(1*8)=179
179 % 10 = 9
So 690632-68-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2O/c1-3-12(4-2)10-6-5-9(8-13)7-11-10/h5-7,13H,3-4,8H2,1-2H3
