737797-22-7 Usage
Uses
Used in Organic Synthesis:
2,3-DIMETHOXYBENZYLZINC CHLORIDE is used as a reagent for the formation of carbon-carbon bonds through cross-coupling reactions. Its application is crucial in the synthesis of complex organic molecules due to its efficient addition of the 2,3-dimethoxybenzyl group to various substrates.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,3-DIMETHOXYBENZYLZINC CHLORIDE is used as a key intermediate in the production of various active pharmaceutical ingredients. Its unique properties and reactivity make it suitable for the synthesis of complex drug molecules, contributing to the development of new therapeutic agents.
Used in Agrochemical Industry:
2,3-DIMETHOXYBENZYLZINC CHLORIDE also finds applications in the agrochemical industry, where it is utilized in the synthesis of various active ingredients for pesticides and other agrochemical products. Its role in creating complex organic molecules aids in the development of innovative and effective agrochemicals for agricultural and environmental applications.
Check Digit Verification of cas no
The CAS Registry Mumber 737797-22-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,3,7,7,9 and 7 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 737797-22:
(8*7)+(7*3)+(6*7)+(5*7)+(4*9)+(3*7)+(2*2)+(1*2)=217
217 % 10 = 7
So 737797-22-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H11O2.ClH.Zn/c1-7-5-4-6-8(10-2)9(7)11-3;;/h4-6H,1H2,2-3H3;1H;/q;;+1/p-1/rC9H11ClO2Zn/c1-11-8-5-3-4-7(6-13-10)9(8)12-2/h3-5H,6H2,1-2H3
