75896-70-7 Usage
Uses
Used in Pharmaceutical Industry:
2-METHYL-4,6,7-TRICHLOROQUINOLINE is used as a reagent for the preparation of analogs of echinorine, which are compounds with potential pharmaceutical applications. The synthesis of these analogs can lead to the development of new drugs with improved therapeutic properties.
Used in Chemical Research:
In the field of chemical research, 2-METHYL-4,6,7-TRICHLOROQUINOLINE can be utilized as a starting material or intermediate for the synthesis of various complex organic molecules. Its unique structure allows for further functionalization and modification, enabling the creation of novel compounds with specific properties and applications.
Used in Material Science:
2-METHYL-4,6,7-TRICHLOROQUINOLINE may also find applications in material science, particularly in the development of new materials with tailored properties. Its chemical structure can be exploited to design and synthesize materials with specific characteristics, such as improved stability, reactivity, or selectivity in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 75896-70-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,8,9 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 75896-70:
(7*7)+(6*5)+(5*8)+(4*9)+(3*6)+(2*7)+(1*0)=187
187 % 10 = 7
So 75896-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H6Cl3N/c1-5-2-7(11)6-3-8(12)9(13)4-10(6)14-5/h2-4H,1H3
