776277-28-2 Usage
Uses
Used in Pharmaceutical Industry:
5-Aminomethyl-furan-2-carbonitrile is used as a key intermediate for the development of new drugs, particularly targeting central nervous system disorders and cancer. Its unique structure allows for the creation of compounds with potential therapeutic effects in these areas.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Aminomethyl-furan-2-carbonitrile serves as a building block in the synthesis of various agrochemicals, contributing to the development of effective pest control agents and other agricultural products.
Used in Specialty Chemicals Production:
5-Aminomethyl-furan-2-carbonitrile is utilized in the production of specialty chemicals, where its distinctive molecular structure provides specific properties required for advanced applications in various industries.
Used in Research Reagents:
As a research reagent, 5-Aminomethyl-furan-2-carbonitrile is employed in scientific studies and experiments, aiding in the exploration of new chemical reactions and the synthesis of novel compounds.
It is crucial to handle 5-Aminomethyl-furan-2-carbonitrile with caution due to its potential hazardous properties, ensuring safety in its application across different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 776277-28-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,6,2,7 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 776277-28:
(8*7)+(7*7)+(6*6)+(5*2)+(4*7)+(3*7)+(2*2)+(1*8)=212
212 % 10 = 2
So 776277-28-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O/c7-3-5-1-2-6(4-8)9-5/h1-2H,3,7H2
