79516-40-8 Usage
Uses
Used in Epoxy Resin Systems:
2,3,5,6-tetramethylcyclohexane-1,4-diamine is used as a curing agent or hardener in epoxy resin systems. It plays a crucial role in the cross-linking process, which enhances the mechanical properties and durability of the final product.
Used in Corrosion Inhibition:
2,3,5,6-tetramethylcyclohexane-1,4-diamine is used as a corrosion inhibitor. Its ability to form protective films on metal surfaces helps prevent corrosion, making it a valuable component in coatings and other protective applications.
Used in Polymer Chemistry:
2,3,5,6-tetramethylcyclohexane-1,4-diamine is utilized as a cross-linking agent in polymer chemistry. It facilitates the formation of a three-dimensional network within polymers, improving their structural integrity and performance characteristics.
In the Chemical Industry:
2,3,5,6-tetramethylcyclohexane-1,4-diamine is used as an intermediate in the synthesis of various chemical products, including dyes, pharmaceuticals, and agrochemicals, due to its reactive amino groups.
As a Specialty Chemical:
2,3,5,6-tetramethylcyclohexane-1,4-diamine is used in the development of specialty chemicals that require specific reactivity or properties, such as those needed in advanced materials or niche applications.
Check Digit Verification of cas no
The CAS Registry Mumber 79516-40-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,5,1 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 79516-40:
(7*7)+(6*9)+(5*5)+(4*1)+(3*6)+(2*4)+(1*0)=158
158 % 10 = 8
So 79516-40-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H22N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h5-10H,11-12H2,1-4H3
