797806-70-3 Usage
Uses
Used in Pharmaceutical and Medicinal Chemistry:
[(4-METHYL-FURAZAN-3-CARBONYL)-AMINO]-ACETIC ACID is used as a building block for the development of new drugs and therapies due to its unique chemical structure and potential interactions with biological targets.
Used in Chemical Research and Development:
[(4-METHYL-FURAZAN-3-CARBONYL)-AMINO]-ACETIC ACID is utilized as a research tool in chemical laboratories to explore its properties, reactivity, and potential applications in various chemical processes and reactions.
Used in Drug Design and Synthesis:
[(4-METHYL-FURAZAN-3-CARBONYL)-AMINO]-ACETIC ACID is employed as a key intermediate in the synthesis of complex pharmaceutical compounds, potentially leading to the creation of novel therapeutic agents.
Used in Drug Delivery Systems:
In the field of drug delivery, this compound may be used as a component in the design of targeted drug delivery systems, potentially enhancing the bioavailability and efficacy of associated therapeutic agents.
Used in Anticancer Applications:
While not explicitly mentioned in the provided materials, given the compound's potential utility in pharmaceutical and medicinal chemistry, it is conceivable that [(4-METHYL-FURAZAN-3-CARBONYL)-AMINO]-ACETIC ACID could be investigated for its potential as an anticancer agent, similar to other compounds in its class.
Used in Diagnostic Applications:
[(4-METHYL-FURAZAN-3-CARBONYL)-AMINO]-ACETIC ACID's unique properties may also make it suitable for use in the development of diagnostic tools and imaging agents, particularly if it can be modified to selectively bind to specific biological targets or be detected through various imaging techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 797806-70-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,7,8,0 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 797806-70:
(8*7)+(7*9)+(6*7)+(5*8)+(4*0)+(3*6)+(2*7)+(1*0)=233
233 % 10 = 3
So 797806-70-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3O4/c1-3-5(9-13-8-3)6(12)7-2-4(10)11/h2H2,1H3,(H,7,12)(H,10,11)