83244-81-9 Usage
Uses
Used in Pharmaceutical Industry:
[(5-methyl-1,3,4-thiadiazol-2-yl)amino](oxo)acetic acid is used as a pharmaceutical agent for its potential therapeutic effects in treating various diseases. Its unique chemical structure allows it to interact with biological targets, offering a promising avenue for drug development.
Used in Organic Synthesis:
In the field of organic chemistry, [(5-methyl-1,3,4-thiadiazol-2-yl)amino](oxo)acetic acid serves as a key building block in the synthesis of other complex organic compounds. Its reactivity and structural features make it a valuable component in creating novel molecules with specific properties and applications.
Used in Medicinal Chemistry Research:
[(5-methyl-1,3,4-thiadiazol-2-yl)amino](oxo)acetic acid is utilized as a subject of study in medicinal chemistry research to explore its potential pharmacological properties and mechanisms of action. Understanding its interactions with biological systems can lead to the discovery of new therapeutic agents and treatment strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 83244-81-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,2,4 and 4 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 83244-81:
(7*8)+(6*3)+(5*2)+(4*4)+(3*4)+(2*8)+(1*1)=129
129 % 10 = 9
So 83244-81-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O3S/c1-2-7-8-5(12-2)6-3(9)4(10)11/h1H3,(H,10,11)(H,6,8,9)
