845551-41-9 Usage
Uses
Used in Organic Synthesis:
2-Butoxy-3,5-dimethylphenylboronic acid is used as a reagent in organic synthesis for its ability to form stable complexes with diols and other molecules, facilitating cross-coupling reactions and the formation of C-C bonds. This makes it a valuable component in the synthesis of various organic compounds and pharmaceuticals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-Butoxy-3,5-dimethylphenylboronic acid is used as a building block for the development of new drugs. Its reactivity in organic synthesis allows for the creation of complex molecular structures that can target specific biological pathways, potentially leading to the discovery of novel therapeutic agents.
Used in Chemical Research:
2-Butoxy-3,5-dimethylphenylboronic acid is also utilized in chemical research as a model compound to study the properties and reactions of boronic acids. This helps in understanding the fundamental chemistry of these compounds and can contribute to the development of new synthetic methods and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 845551-41-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,5,5,5 and 1 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 845551-41:
(8*8)+(7*4)+(6*5)+(5*5)+(4*5)+(3*1)+(2*4)+(1*1)=179
179 % 10 = 9
So 845551-41-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H19BO3/c1-4-5-6-16-12-9(2)7-11(13(14)15)8-10(12)3/h7-8,14-15H,4-6H2,1-3H3
