850567-39-4 Usage
Uses
Used in Organic Synthesis:
3-(DIPROPYLCARBAMOYL)PHENYLBORONIC ACID is used as a building block in the synthesis of biaryl and heterocyclic compounds, which are essential components in many organic molecules and pharmaceuticals.
Used in Pharmaceutical Industry:
3-(DIPROPYLCARBAMOYL)PHENYLBORONIC ACID is used as a reagent in Suzuki-Miyaura cross-coupling reactions, a widely employed method in the synthesis of pharmaceuticals and agrochemicals. This reaction allows for the formation of carbon-carbon bonds, facilitating the creation of complex molecular structures.
Used in Medicinal Chemistry:
3-(DIPROPYLCARBAMOYL)PHENYLBORONIC ACID has potential applications in medicinal chemistry due to its ability to inhibit proteases and other enzymes. This property makes it a promising candidate for the development of drugs targeting specific enzymatic pathways involved in various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-39-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 850567-39:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*3)+(1*9)=184
184 % 10 = 4
So 850567-39-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H20BNO3/c1-3-8-15(9-4-2)13(16)11-6-5-7-12(10-11)14(17)18/h5-7,10,17-18H,3-4,8-9H2,1-2H3
