850568-13-7 Usage
Uses
Used in Pharmaceutical Synthesis:
4-(Isobutylaminocarbonyl)phenylboronic acid is utilized as a key intermediate in the synthesis of pharmaceuticals. Its ability to participate in various chemical reactions, such as the Suzuki-Miyaura cross-coupling reaction, facilitates the formation of carbon-carbon bonds, which is crucial for constructing complex organic compounds with potential medicinal properties.
Used in Agrochemical Production:
In the agrochemical industry, 4-(Isobutylaminocarbonyl)phenylboronic acid serves as a vital building block for the development of new agrochemicals. Its reactivity in chemical reactions allows for the creation of novel compounds with improved pesticidal or herbicidal activities, contributing to more effective crop protection strategies.
Used in Organic Synthesis:
4-(Isobutylaminocarbonyl)phenylboronic acid is employed as a reagent in organic synthesis for the formation of carbon-carbon bonds through the Suzuki-Miyaura cross-coupling reaction. This widely used method is essential for constructing complex organic compounds, including those with potential applications in materials science, chemical research, and the development of new pharmaceuticals and agrochemicals.
Overall, the versatile nature of 4-(Isobutylaminocarbonyl)phenylboronic acid, with its capacity to engage in multiple chemical reactions, positions it as a valuable tool across various industries, particularly in the synthesis of pharmaceuticals, agrochemicals, and other complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-13-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 850568-13:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*1)+(1*3)=177
177 % 10 = 7
So 850568-13-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H16BNO3/c1-8(2)7-13-11(14)9-3-5-10(6-4-9)12(15)16/h3-6,8,15-16H,7H2,1-2H3,(H,13,14)
