86357-20-2 Usage
Uses
Used in Pharmaceutical Industry:
IMp. I (EP): 2-[(2-AMino-6-oxo-1,6-dihydro-9H-purin-9-yl)Methoxy]propane-1,3-diylDipropanoate (Ganciclovir Dipropionate) is used as an antiviral agent for the treatment of various viral infections, particularly those caused by herpes simplex virus (HSV) and cytomegalovirus (CMV). Its antiviral properties make it a valuable component in the development of medications to combat viral diseases.
Used in Research and Development:
In the field of research and development, IMp. I (EP): 2-[(2-AMino-6-oxo-1,6-dihydro-9H-purin-9-yl)Methoxy]propane-1,3-diylDipropanoate (Ganciclovir Dipropionate) serves as a valuable compound for studying the mechanisms of action and potential applications of nucleoside analogs in antiviral therapy. This can lead to the discovery of new treatments and advancements in the field of virology.
Check Digit Verification of cas no
The CAS Registry Mumber 86357-20-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,6,3,5 and 7 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 86357-20:
(7*8)+(6*6)+(5*3)+(4*5)+(3*7)+(2*2)+(1*0)=152
152 % 10 = 2
So 86357-20-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H21N5O6/c1-3-10(21)24-5-9(6-25-11(22)4-2)26-8-20-7-17-12-13(20)18-15(16)19-14(12)23/h7,9H,3-6,8H2,1-2H3,(H3,16,18,19,23)