864075-95-6 Usage
Uses
Used in Pharmaceutical Industry:
3-(5-NITROPYRIDIN-2-YL)BENZOIC ACID is used as a key building block for the synthesis of various drugs and active pharmaceutical ingredients. Its unique structure allows for the creation of bioactive molecules with potential therapeutic applications.
Used in Organic Synthesis:
In the realm of organic synthesis, 3-(5-NITROPYRIDIN-2-YL)BENZOIC ACID is utilized as a starting material for the production of other compounds. Its reactivity and functional groups make it a valuable precursor in the synthesis of a range of organic molecules.
Used in Medicinal Chemistry and Drug Discovery:
3-(5-NITROPYRIDIN-2-YL)BENZOIC ACID is employed as an intermediate in the synthesis of bioactive molecules, playing a crucial role in medicinal chemistry and drug discovery. Its potential applications in these fields highlight its importance in the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 864075-95-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,4,0,7 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 864075-95:
(8*8)+(7*6)+(6*4)+(5*0)+(4*7)+(3*5)+(2*9)+(1*5)=196
196 % 10 = 6
So 864075-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2O4/c15-12(16)9-3-1-2-8(6-9)11-5-4-10(7-13-11)14(17)18/h1-7H,(H,15,16)
864075-95-6Relevant articles and documents
AMINO ACIDS
-
Page/Page column 50-51, (2008/06/13)
Compounds of formula (I): Z’ -CO-A-B-NH-Z (I) wherein: Z is H or an amino protecting group; Z’ is OH, a protected or activated hydroxyl group or C1; A is an optionally substituted C5-6 arylene group; and B is an optionally substituted C5-6 arylene group.
