864779-06-6 Usage
Uses
Used in Pharmaceutical Synthesis:
Quinoline, 4-(bromomethyl)-2-methylis utilized as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications, such as antimicrobial, antifungal, and anticancer agents.
Used in Dye Production:
Quinoline, 4-(bromomethyl)-2-methylis also used in the production of dyes, where its chemical properties contribute to the color and stability of the dyes. Its versatility in chemical reactions enables the creation of a wide range of dyes for various applications, including textiles, plastics, and printing inks.
Used in Agrochemical Development:
Quinoline, 4-(bromomethyl)-2-methylis employed in the development of agrochemicals, particularly as a precursor for the synthesis of pesticides and fungicides. Its antimicrobial and antifungal properties make it a valuable component in the creation of effective crop protection products.
Used in Organic Synthesis:
As a precursor in the synthesis of various organic compounds, Quinoline, 4-(bromomethyl)-2-methylis used in research and industrial applications. Its ability to participate in a range of chemical reactions, such as nucleophilic substitution and electrophilic aromatic substitution, makes it a versatile building block for the synthesis of complex organic molecules.
Used in Research Applications:
In the field of research, Quinoline, 4-(bromomethyl)-2-methylis used to study the properties and reactions of quinoline derivatives. Its unique structure provides insights into the reactivity and selectivity of various chemical transformations, contributing to the advancement of organic chemistry and related disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 864779-06-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,4,7,7 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 864779-06:
(8*8)+(7*6)+(6*4)+(5*7)+(4*7)+(3*9)+(2*0)+(1*6)=226
226 % 10 = 6
So 864779-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrN/c1-8-6-9(7-12)10-4-2-3-5-11(10)13-8/h2-6H,7H2,1H3
864779-06-6Relevant articles and documents
Substituted Heterocyclic Ethers and Their Use in CNS Disorders
-
Page/Page column 20, (2009/01/24)
The invention encompasses compounds of Formula I, including pharmaceutically acceptable salts, their pharmaceutical compositions, and their use in treating CNS disorders.
