868948-12-3 Usage
Uses
Used in Pharmaceutical Industry:
Butanamide, N-(6-chloro-3-pyridazinyl)is used as an intermediate in the synthesis of pharmaceutical drugs for its potential therapeutic effects. Its unique chemical structure allows it to be a promising candidate for the development of new drugs with various medicinal properties.
Used in Medicinal Chemistry Research:
Butanamide, N-(6-chloro-3-pyridazinyl)is used as a research compound in medicinal chemistry to explore its potential as a therapeutic agent. Its chemical structure provides a foundation for further modification and optimization to enhance its pharmacological properties and improve its efficacy in treating various diseases.
Used in Drug Development:
Butanamide, N-(6-chloro-3-pyridazinyl)is used in drug development to create new pharmaceutical drugs with potential therapeutic effects. Its unique structure and properties make it a valuable compound for the design and synthesis of novel drugs targeting specific medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 868948-12-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,8,9,4 and 8 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 868948-12:
(8*8)+(7*6)+(6*8)+(5*9)+(4*4)+(3*8)+(2*1)+(1*2)=243
243 % 10 = 3
So 868948-12-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN3O/c1-2-3-8(13)10-7-5-4-6(9)11-12-7/h4-5H,2-3H2,1H3,(H,10,12,13)
