870777-18-7 Usage
Uses
Used in Organic Synthesis:
2-FLUORO-6-PROPOXYPHENYLBORONIC ACID is used as a building block in organic synthesis for the preparation of various biologically active molecules. Its unique structure and reactivity enable the formation of stable complexes with a wide range of organic molecules, facilitating the synthesis of complex organic compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-FLUORO-6-PROPOXYPHENYLBORONIC ACID is employed as a key intermediate in the development of new drugs. Its ability to form stable complexes with organic molecules allows for the creation of novel drug candidates with potential therapeutic applications.
Used in Material Science:
2-FLUORO-6-PROPOXYPHENYLBORONIC ACID is utilized in the development of new materials due to its versatile nature and potential applications. Its ability to form stable complexes with various organic molecules contributes to the creation of innovative materials with unique properties.
Used as a Reagent in Pharmaceutical Production:
In the production of pharmaceutical intermediates, 2-FLUORO-6-PROPOXYPHENYLBORONIC ACID serves as a crucial reagent. Its unique properties and reactivity make it an essential component in the synthesis of intermediates that are further used in the development of new drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 870777-18-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,7,7 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 870777-18:
(8*8)+(7*7)+(6*0)+(5*7)+(4*7)+(3*7)+(2*1)+(1*8)=207
207 % 10 = 7
So 870777-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BFO3/c1-2-6-14-8-5-3-4-7(11)9(8)10(12)13/h3-5,12-13H,2,6H2,1H3
