870778-89-5 Usage
Uses
Used in Chemical Synthesis:
2,4-DIBUTOXYPHENYLBORONIC ACID is used as a reactant for the synthesis of various organic compounds, including phenoxazine dyes and chromophores.
Used in Dye-Sensitized Solar Cells (DSSCs):
2,4-DIBUTOXYPHENYLBORONIC ACID is used as a reactant for the synthesis of phenoxazine dyes, which are employed in dye-sensitized solar cells. These dyes play a crucial role in the light-harvesting process, enhancing the efficiency of solar energy conversion.
Used in Research and Development:
2,4-DIBUTOXYPHENYLBORONIC ACID is used as a reactant for the synthesis of donors, which are essential for the comparison of structural and spectral characteristics of chromophores in dye-sensitized solar cells. This helps researchers understand the relationship between molecular structure and performance, leading to the development of more efficient solar cell materials.
Check Digit Verification of cas no
The CAS Registry Mumber 870778-89-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,7,7 and 8 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 870778-89:
(8*8)+(7*7)+(6*0)+(5*7)+(4*7)+(3*8)+(2*8)+(1*9)=225
225 % 10 = 5
So 870778-89-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H23BO4/c1-3-5-9-18-12-7-8-13(15(16)17)14(11-12)19-10-6-4-2/h7-8,11,16-17H,3-6,9-10H2,1-2H3
