871332-85-3 Usage
Uses
Used in Organic Synthesis:
3-(Cyclohexylcarbamoyl)-5-nitrophenylboronic acid is used as a reagent in organic synthesis for the preparation of various compounds. Its unique structure allows for versatile reactions and the formation of diverse chemical entities, making it a valuable tool in the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-(Cyclohexylcarbamoyl)-5-nitrophenylboronic acid is employed as a reagent for the synthesis of pharmaceutical compounds. Its potential as a pharmaceutical intermediate has been studied, and it may contribute to the development of new drugs with improved therapeutic properties.
Used in Pharmaceutical Industry:
3-(Cyclohexylcarbamoyl)-5-nitrophenylboronic acid is used as a key intermediate in the pharmaceutical industry for the development of novel drugs. Its unique chemical properties and reactivity make it a promising candidate for the synthesis of bioactive molecules with potential therapeutic applications.
Used in Suzuki-Miyaura Cross-Coupling Reaction:
3-(Cyclohexylcarbamoyl)-5-nitrophenylboronic acid is utilized in the Suzuki-Miyaura cross-coupling reaction, a widely employed method for the formation of carbon-carbon bonds. This reaction is crucial in the synthesis of various organic compounds, including those with pharmaceutical relevance, and the use of this boronic acid derivative enhances the scope and efficiency of this process.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-85-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 871332-85:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*8)+(1*5)=173
173 % 10 = 3
So 871332-85-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H17BN2O5/c17-13(15-11-4-2-1-3-5-11)9-6-10(14(18)19)8-12(7-9)16(20)21/h6-8,11,18-19H,1-5H2,(H,15,17)
