874219-27-9 Usage
Uses
Used in Organic Synthesis:
3-(DIMETHYLCARBAMOYL)-4-FLUOROBENZENEBORONIC ACID is used as a reagent for the formation of carbon-carbon and carbon-heteroatom bonds, facilitating the synthesis of complex organic molecules.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-(DIMETHYLCARBAMOYL)-4-FLUOROBENZENEBORONIC ACID is utilized as a reagent for the development of pharmaceuticals, owing to its ability to form stable complexes with biological targets and contribute to the creation of potential drug candidates.
Used in Pharmaceutical Development:
3-(DIMETHYLCARBAMOYL)-4-FLUOROBENZENEBORONIC ACID is employed as a key intermediate in the synthesis of various pharmaceuticals, leveraging its reactivity and binding properties to enhance drug efficacy and target specificity.
Used in Agrochemical Development:
3-(DIMETHYLCARBAMOYL)-4-FLUOROBENZENEBORONIC ACID is also used in the development of agrochemicals, where its ability to form stable complexes can be applied to create effective and targeted pesticides or other agricultural products.
Used in Molecular Imaging:
3-(DIMETHYLCARBAMOYL)-4-FLUOROBENZENEBORONIC ACID has been studied for its potential use in imaging agents and diagnostic tools within the field of molecular imaging, where its unique properties may contribute to the advancement of diagnostic techniques and imaging agents.
Check Digit Verification of cas no
The CAS Registry Mumber 874219-27-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,1 and 9 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 874219-27:
(8*8)+(7*7)+(6*4)+(5*2)+(4*1)+(3*9)+(2*2)+(1*7)=189
189 % 10 = 9
So 874219-27-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BFNO3/c1-12(2)9(13)7-5-6(10(14)15)3-4-8(7)11/h3-5,14-15H,1-2H3