874219-39-3 Usage
Uses
Used in Organic Synthesis:
5-(DIMETHYLCARBAMOYL)-3-FLUOROBENZENEBORONIC ACID is used as a building block for the production of various pharmaceuticals and biologically active compounds. Its unique structure allows for the creation of diverse molecules with potential therapeutic properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-(DIMETHYLCARBAMOYL)-3-FLUOROBENZENEBORONIC ACID is utilized as a key intermediate in the synthesis of new drugs. Its reactivity and functional groups enable the development of innovative pharmaceutical agents with improved efficacy and selectivity.
Used in Cross-Coupling Reactions:
5-(DIMETHYLCARBAMOYL)-3-FLUOROBENZENEBORONIC ACID is used as a valuable reagent in cross-coupling reactions, particularly in the Suzuki-Miyaura coupling reaction. Its ability to form stable boronate complexes with aryl and vinyl halides facilitates the formation of carbon-carbon bonds, which are crucial for the synthesis of complex organic molecules.
Used in Drug Development:
In the development of new drugs, 5-(DIMETHYLCARBAMOYL)-3-FLUOROBENZENEBORONIC ACID serves as a promising starting material. Its unique properties and reactivity contribute to the discovery of novel therapeutic agents with potential applications in various medical fields.
Used in Agrochemicals and Materials:
5-(DIMETHYLCARBAMOYL)-3-FLUOROBENZENEBORONIC ACID also has potential applications in the development of agrochemicals and materials. Its versatility and reactivity make it a valuable component in the creation of new products with improved performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 874219-39-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,1 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 874219-39:
(8*8)+(7*7)+(6*4)+(5*2)+(4*1)+(3*9)+(2*3)+(1*9)=193
193 % 10 = 3
So 874219-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BFNO3/c1-12(2)9(13)6-3-7(10(14)15)5-8(11)4-6/h3-5,14-15H,1-2H3