874289-50-6 Usage
Uses
Used in Organic Synthesis:
5-(Butylcarbamoyl)-2-fluorobenzeneboronic acid is used as a reagent in Suzuki-Miyaura cross-coupling reactions for the formation of carbon-carbon bonds in the construction of organic compounds. Its boronic acid functionality allows it to participate in various chemical reactions, making it an essential building block for the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-(Butylcarbamoyl)-2-fluorobenzeneboronic acid is used as a key intermediate in the development of new drugs and pharmaceuticals. Its unique structure and reactivity make it a valuable tool for chemists and researchers working in medicinal chemistry, enabling the creation of novel therapeutic agents with improved efficacy and selectivity.
Used in Fine Chemicals Production:
5-(Butylcarbamoyl)-2-fluorobenzeneboronic acid is also employed as a building block in the production of fine chemicals, which are high-purity chemicals used in various applications, including pharmaceuticals, agrochemicals, and specialty materials. Its versatility and reactivity contribute to the synthesis of high-quality fine chemicals with specific properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 874289-50-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 9 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 874289-50:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*9)+(2*5)+(1*0)=216
216 % 10 = 6
So 874289-50-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H15BFNO3/c1-2-3-6-14-11(15)8-4-5-10(13)9(7-8)12(16)17/h4-5,7,16-17H,2-3,6H2,1H3,(H,14,15)
