874290-89-8 Usage
Uses
Used in Organic Synthesis:
3-Cyanopyridin-4-ylboronic acid is used as a reagent for facilitating the Suzuki coupling reaction, a powerful method for the formation of carbon-carbon bonds. This reaction is crucial in the synthesis of complex organic molecules and plays a significant role in the development of new chemical compounds.
Used in Pharmaceutical and Agrochemical Synthesis:
In the pharmaceutical and agrochemical industries, 3-Cyanopyridin-4-ylboronic acid is utilized as a key intermediate in the synthesis of various drugs and agrochemicals. Its unique structure allows for the creation of novel compounds with potential therapeutic and pesticidal properties.
Used in Materials Science:
3-Cyanopyridin-4-ylboronic acid finds applications in materials science, particularly in the production of functionalized polymers and organic electronic devices. Its incorporation into these materials can enhance their properties, such as conductivity, stability, and responsiveness, making them suitable for various applications in electronics and other industries.
Check Digit Verification of cas no
The CAS Registry Mumber 874290-89-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,9 and 0 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 874290-89:
(8*8)+(7*7)+(6*4)+(5*2)+(4*9)+(3*0)+(2*8)+(1*9)=208
208 % 10 = 8
So 874290-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BN2O2/c8-3-5-4-9-2-1-6(5)7(10)11/h1-2,4,10-11H
874290-89-8Relevant articles and documents
Method for preparing aromatic boronic acid
-
Paragraph 0042; 0043, (2017/04/04)
The invention discloses a method for preparing aromatic ring boric acid, which comprises the following steps of: (1) firstly, leading the mixed solution of aromatic ring compounds, n-butyllithium and a chelant with nitrogen heterocycle to have a reaction
Synthesis of ortho-cyanopyridylboronic acids and esters toward cyano-functionalized bipyridines
Cailly, Thomas,Fabis, Frédéric,Bouillon, Alexandre,Lema?tre, Stéphane,Sopkova, Jana,De Santos, Olivieira,Rault, Sylvain
, p. 53 - 56 (2007/10/03)
This work describes the synthesis of ortho-cyanopyridylboronic acids and esters. Their reactivity with pyridine halides in the Suzuki cross-coupling reaction is evaluated and shows that the cyanopyridyl boronic esters appear to be more stable than their corresponding acids. These esters allowed us to synthesize new cyanobipyridine systems. Georg Thieme Verlag Stuttgart.
