878668-47-4 Usage
Uses
Used in Pharmaceutical Industry:
1-(4-AMINO-PHENOXY)-3-IMIDAZOL-1-YL-PROPAN-2-OL is used as a potential antifungal or antiviral agent for its possible interaction with specific proteins or enzymes in the body, which may contribute to its biological activity against infections.
1-(4-AMINO-PHENOXY)-3-IMIDAZOL-1-YL-PROPAN-2-OL's structure and properties suggest that it could be further explored and developed for use in various medical applications, particularly in the treatment of fungal and viral infections. Its potential therapeutic effects are attributed to the presence of the imidazole ring and the specific functional groups in its molecular structure, which may allow for targeted interactions with biological targets.
Check Digit Verification of cas no
The CAS Registry Mumber 878668-47-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,8,6,6 and 8 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 878668-47:
(8*8)+(7*7)+(6*8)+(5*6)+(4*6)+(3*8)+(2*4)+(1*7)=254
254 % 10 = 4
So 878668-47-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3O2/c13-10-1-3-12(4-2-10)17-8-11(16)7-15-6-5-14-9-15/h1-6,9,11,16H,7-8,13H2
