879275-70-4 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
2-Difluoromethyl-phenylboronic acid serves as a key building block in the synthesis of various pharmaceutical and agrochemical compounds. Its unique structure and functional groups facilitate the development of novel molecules with enhanced properties and therapeutic potential.
Used in Organic Synthesis:
In the field of organic synthesis, 2-Difluoromethyl-phenylboronic acid is utilized as a versatile intermediate for the creation of complex organic molecules. Its ability to participate in Suzuki-Miyaura cross-coupling reactions allows for the efficient formation of carbon-carbon bonds, which is crucial for the synthesis of a wide range of organic compounds.
Used in Drug Discovery:
2-Difluoromethyl-phenylboronic acid is employed as a valuable tool in drug discovery, where its unique properties and reactivity contribute to the design and synthesis of new drug candidates. Its potential role in the development of anti-cancer agents makes it a promising candidate for further research and exploration in medicinal chemistry.
Used in Material Science:
In the realm of material science, 2-Difluoromethyl-phenylboronic acid is leveraged for its distinctive properties, which can be harnessed to develop new materials with specific characteristics. Its reactivity and functional groups make it a suitable candidate for the synthesis of advanced materials with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 879275-70-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,9,2,7 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 879275-70:
(8*8)+(7*7)+(6*9)+(5*2)+(4*7)+(3*5)+(2*7)+(1*0)=234
234 % 10 = 4
So 879275-70-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BF2O2/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,7,11-12H
