879326-81-5 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-5-dimethoxymethyl-pyridine is utilized as an intermediate in the production of various drugs, contributing to the development of new medications. Its specific applications and properties may vary depending on the context and requirements of the pharmaceutical formulations.
Used in Organic Synthesis:
As a reagent in organic synthesis, 3-chloro-5-dimethoxymethyl-pyridine plays a crucial role in the synthesis of complex organic compounds. Its unique structure allows for versatile chemical reactions, facilitating the creation of a wide range of organic molecules for various applications.
Potential Applications in Medication Development:
Due to its distinctive chemical structure, 3-chloro-5-dimethoxymethyl-pyridine may exhibit various pharmacological activities, making it a promising candidate for the development of new medications. Further research and experimentation are necessary to explore its full potential in the field of drug discovery and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 879326-81-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,9,3,2 and 6 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 879326-81:
(8*8)+(7*7)+(6*9)+(5*3)+(4*2)+(3*6)+(2*8)+(1*1)=225
225 % 10 = 5
So 879326-81-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClNO2/c1-11-8(12-2)6-3-7(9)5-10-4-6/h3-5,8H,1-2H3
