883542-90-3 Usage
Uses
Used in Pharmaceutical Synthesis:
(3-METHYL-PIPERIDIN-1-YL)-ACETIC ACID is used as a key intermediate in the synthesis of various pharmaceutical drugs and organic compounds. Its structural features make it a valuable building block for creating new molecules with specific therapeutic effects.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (3-METHYL-PIPERIDIN-1-YL)-ACETIC ACID is used as a starting material for the development of novel drug candidates. Its chemical properties allow for the creation of derivatives that can target specific biological pathways or receptors, potentially leading to the discovery of new treatments for various diseases.
Used in Drug Discovery:
(3-METHYL-PIPERIDIN-1-YL)-ACETIC ACID is utilized in drug discovery processes to identify and optimize compounds with potential therapeutic applications. Its ability to be modified and interact with biological targets makes it a promising candidate for the development of new medications.
Used in Specialty Chemicals Production:
Beyond its pharmaceutical applications, (3-METHYL-PIPERIDIN-1-YL)-ACETIC ACID may also be used in the production of specialty chemicals, where its unique chemical structure can contribute to the development of advanced materials or chemical products.
Used in Organic Synthesis:
As a building block for organic synthesis, (3-METHYL-PIPERIDIN-1-YL)-ACETIC ACID is employed in the creation of complex organic molecules for a variety of applications, including but not limited to, research, industrial processes, and the development of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 883542-90-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,3,5,4 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 883542-90:
(8*8)+(7*8)+(6*3)+(5*5)+(4*4)+(3*2)+(2*9)+(1*0)=203
203 % 10 = 3
So 883542-90-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2/c1-7-3-2-4-9(5-7)6-8(10)11/h7H,2-6H2,1H3,(H,10,11)
